About 4-methylpentylazanium
4-methylpentylazanium (PubChem CID 22348722) has the molecular formula C6H16N+
and a molecular weight of 102.20 g/mol. Its IUPAC name is 4-methylpentylazanium.
Molecular Properties
| Compound Name | 4-methylpentylazanium |
| PubChem CID | 22348722 |
| Molecular Formula | C6H16N+ |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.13 |
| IUPAC Name | 4-methylpentylazanium |
| SMILES | CC(C)CCC[NH3+] |
| InChI | InChI=1S/C6H15N/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3/p+1 |
| InChIKey | QVIAMKXOQGCYCV-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methylpentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentylazanium?
The IUPAC name of 4-methylpentylazanium (CID 22348722) is 4-methylpentylazanium.
What is the SMILES notation for 4-methylpentylazanium?
The canonical SMILES for 4-methylpentylazanium is CC(C)CCC[NH3+].
What is the InChIKey of 4-methylpentylazanium?
The InChIKey is QVIAMKXOQGCYCV-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N/c1-6(2)4-3-5-7/h6H,3-5,7H2,1-2H3/p+1.
What are the key properties of 4-methylpentylazanium?
4-methylpentylazanium has a molecular weight of 102.20 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentylazanium is sourced from PubChem (CID 22348722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).