About 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium
1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium (PubChem CID 159027387) has the molecular formula C16H39N3+2
and a molecular weight of 273.51 g/mol. Its IUPAC name is 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium.
Molecular Properties
| Compound Name | 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium |
| PubChem CID | 159027387 |
| Molecular Formula | C16H39N3+2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 273.31 |
| IUPAC Name | 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium |
| SMILES | C/C(N)=[NH+]\CCCCC(C)C.CC(C)CCCC[NH3+] |
| InChI | InChI=1S/C9H20N2.C7H17N/c1-8(2)6-4-5-7-11-9(3)10;1-7(2)5-3-4-6-8/h8H,4-7H2,1-3H3,(H2,10,11);7H,3-6,8H2,1-2H3/p+2 |
| InChIKey | JULJDGGXJYXVQU-UHFFFAOYSA-P |
| XLogP | 1.33 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium?
The IUPAC name of 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium (CID 159027387) is 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium.
What is the SMILES notation for 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium?
The canonical SMILES for 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium is C/C(N)=[NH+]\CCCCC(C)C.CC(C)CCCC[NH3+].
What is the InChIKey of 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium?
The InChIKey is JULJDGGXJYXVQU-UHFFFAOYSA-P. The full InChI is InChI=1S/C9H20N2.C7H17N/c1-8(2)6-4-5-7-11-9(3)10;1-7(2)5-3-4-6-8/h8H,4-7H2,1-3H3,(H2,10,11);7H,3-6,8H2,1-2H3/p+2.
What are the key properties of 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium?
1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium has a molecular weight of 273.51 g/mol, XLogP of 1.33, 9 rotatable bonds, 3 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethylidene(5-methylhexyl)azanium;5-methylhexylazanium is sourced from PubChem (CID 159027387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).