C21H41NO — CID 144939555
(E)-2,18-dimethylnonadec-2-enamide (PubChem CID 144939555) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is (E)-2,18-dimethylnonadec-2-enamide.
| Compound Name | (E)-2,18-dimethylnonadec-2-enamide |
|---|---|
| PubChem CID | 144939555 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | (E)-2,18-dimethylnonadec-2-enamide |
| SMILES | C/C(=C\CCCCCCCCCCCCCCC(C)C)C(N)=O |
| InChI | InChI=1S/C21H41NO/c1-19(2)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20(3)21(22)23/h18-19H,4-17H2,1-3H3,(H2,22,23)/b20-18+ |
| InChIKey | BYFHIMHIRJBKKS-CZIZESTLSA-N |
| XLogP | 6.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|