C9H17NO3 — CID 91543963
6,6-dimethoxy-2-methylhex-2-enamide (PubChem CID 91543963) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 6,6-dimethoxy-2-methylhex-2-enamide.
| Compound Name | 6,6-dimethoxy-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 91543963 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 6,6-dimethoxy-2-methylhex-2-enamide |
| SMILES | COC(CCC=C(C)C(N)=O)OC |
| InChI | InChI=1S/C9H17NO3/c1-7(9(10)11)5-4-6-8(12-2)13-3/h5,8H,4,6H2,1-3H3,(H2,10,11) |
| InChIKey | HZNDHXWTMUMNEP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|