C12H22O3 — CID 13308241
1,1-dimethoxy-8-methylnon-7-en-4-one (PubChem CID 13308241) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1,1-dimethoxy-8-methylnon-7-en-4-one.
| Compound Name | 1,1-dimethoxy-8-methylnon-7-en-4-one |
|---|---|
| PubChem CID | 13308241 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1,1-dimethoxy-8-methylnon-7-en-4-one |
| SMILES | COC(CCC(=O)CCC=C(C)C)OC |
| InChI | InChI=1S/C12H22O3/c1-10(2)6-5-7-11(13)8-9-12(14-3)15-4/h6,12H,5,7-9H2,1-4H3 |
| InChIKey | FGLBDZCUYQLZMB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|