C16H28O4 — CID 14103326
ethyl (2Z,6E)-10,10-dimethoxy-3,7-dimethyldeca-2,6-dienoate (PubChem CID 14103326) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (2Z,6E)-10,10-dimethoxy-3,7-dimethyldeca-2,6-dienoate.
| Compound Name | ethyl (2Z,6E)-10,10-dimethoxy-3,7-dimethyldeca-2,6-dienoate |
|---|---|
| PubChem CID | 14103326 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethyl (2Z,6E)-10,10-dimethoxy-3,7-dimethyldeca-2,6-dienoate |
| SMILES | CCOC(=O)/C=C(/C)CC/C=C(\C)CCC(OC)OC |
| InChI | InChI=1S/C16H28O4/c1-6-20-15(17)12-14(3)9-7-8-13(2)10-11-16(18-4)19-5/h8,12,16H,6-7,9-11H2,1-5H3/b13-8+,14-12- |
| InChIKey | APGXTXOASKGBMI-LOLOATOISA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|