C25H40O5 — CID 101025386
[(2S)-3-acetyloxy-2-hydroxypropyl] (2Z,6E,10E)-7,11,15-trimethyl-3-(113C)methyl(313C)hexadeca-2,6,10,14-tetraenoate (PubChem CID 101025386) has the molecular formula C25H40O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] (2Z,6E,10E)-7,11,15-trimethyl-3-(113C)methyl(313C)hexadeca-2,6,10,14-tetraenoate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (2Z,6E,10E)-7,11,15-trimethyl-3-(113C)methyl(313C)hexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 101025386 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (2Z,6E,10E)-7,11,15-trimethyl-3-(113C)methyl(313C)hexadeca-2,6,10,14-tetraenoate |
| SMILES | CC(=O)OC[C@H](O)COC(=O)/C=[13C](/[13CH3])CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40O5/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-25(28)30-18-24(27)17-29-23(6)26/h10,12,14,16,24,27H,7-9,11,13,15,17-18H2,1-6H3/b20-12+,21-14+,22-16-/t24-/m0/s1/i5+1,22+1 |
| InChIKey | YRLGSSSUMSWYFS-TZMQIKPISA-N |
| XLogP | 5.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|