C14H24O3 — CID 137492210
4-hydroxybutyl (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 137492210) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-hydroxybutyl (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | 4-hydroxybutyl (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 137492210 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-hydroxybutyl (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)OCCCCO |
| InChI | InChI=1S/C14H24O3/c1-12(2)7-6-8-13(3)11-14(16)17-10-5-4-9-15/h7,11,15H,4-6,8-10H2,1-3H3/b13-11+ |
| InChIKey | RUMWIUDFJVYZOP-ACCUITESSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|