C20H34O4 — CID 161142340
[(8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl] 2,3-dihydroxypropanoate (PubChem CID 161142340) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl] 2,3-dihydroxypropanoate.
| Compound Name | [(8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl] 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 161142340 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl] 2,3-dihydroxypropanoate |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)=CCCCOC(=O)C(O)CO |
| InChI | InChI=1S/C20H34O4/c1-16(2)9-7-11-18(4)13-8-12-17(3)10-5-6-14-24-20(23)19(22)15-21/h9-10,13,19,21-22H,5-8,11-12,14-15H2,1-4H3/b17-10?,18-13+ |
| InChIKey | UNPOEYZJIHGFKS-BLKVHLKTSA-N |
| XLogP | 4.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|