C23H38O4 — CID 148956116
2,3-dihydroxypropyl (6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate (PubChem CID 148956116) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate.
| Compound Name | 2,3-dihydroxypropyl (6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 148956116 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2,3-dihydroxypropyl (6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)=CC(=O)OCC(O)CO |
| InChI | InChI=1S/C23H38O4/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-23(26)27-17-22(25)16-24/h9,11,13,15,22,24-25H,6-8,10,12,14,16-17H2,1-5H3/b19-11+,20-13+,21-15? |
| InChIKey | PQWUWMSVOYKFNP-VUTBRYEJSA-N |
| XLogP | 5.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|