C16H30NO3+ — CID 118183203
[3-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxy-2-hydroxypropyl]-trimethylazanium (PubChem CID 118183203) has the molecular formula C16H30NO3+ and a molecular weight of 284.42 g/mol. Its IUPAC name is [3-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxy-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxy-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 118183203 |
| Molecular Formula | C16H30NO3+ |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | [3-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxy-2-hydroxypropyl]-trimethylazanium |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)OCC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H30NO3/c1-13(2)8-7-9-14(3)10-16(19)20-12-15(18)11-17(4,5)6/h8,10,15,18H,7,9,11-12H2,1-6H3/q+1/b14-10+ |
| InChIKey | FRCYJUYNJJQJIV-GXDHUFHOSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|