C17H26O3 — CID 146405929
acetyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 146405929) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is acetyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | acetyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 146405929 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | acetyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CC(=O)OC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H26O3/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-17(19)20-16(5)18/h8,10,12H,6-7,9,11H2,1-5H3/b14-10+,15-12+ |
| InChIKey | XTNKVSPAMDOJJE-VDQVFBMKSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|