C10H15NO3 — CID 91296458
nitroso 3,7-dimethylocta-2,6-dienoate (PubChem CID 91296458) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is nitroso 3,7-dimethylocta-2,6-dienoate.
| Compound Name | nitroso 3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 91296458 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | nitroso 3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCCC(C)=CC(=O)ON=O |
| InChI | InChI=1S/C10H15NO3/c1-8(2)5-4-6-9(3)7-10(12)14-11-13/h5,7H,4,6H2,1-3H3 |
| InChIKey | GBSBUYQTWVGRDG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|