C11H18O3 — CID 155204253
methyl (2E)-3,7-dimethylocta-2,6-dieneperoxoate (PubChem CID 155204253) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (2E)-3,7-dimethylocta-2,6-dieneperoxoate.
| Compound Name | methyl (2E)-3,7-dimethylocta-2,6-dieneperoxoate |
|---|---|
| PubChem CID | 155204253 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (2E)-3,7-dimethylocta-2,6-dieneperoxoate |
| SMILES | COOC(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C11H18O3/c1-9(2)6-5-7-10(3)8-11(12)14-13-4/h6,8H,5,7H2,1-4H3/b10-8+ |
| InChIKey | HCHYMDJWOBTSNZ-CSKARUKUSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|