C20H30BaO4 — CID 175905407
barium(2+);bis((2Z)-3,7-dimethylocta-2,6-dienoate) (PubChem CID 175905407) has the molecular formula C20H30BaO4 and a molecular weight of 471.78 g/mol. Its IUPAC name is barium(2+);bis((2Z)-3,7-dimethylocta-2,6-dienoate).
| Compound Name | barium(2+);bis((2Z)-3,7-dimethylocta-2,6-dienoate) |
|---|---|
| PubChem CID | 175905407 |
| Molecular Formula | C20H30BaO4 |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | barium(2+);bis((2Z)-3,7-dimethylocta-2,6-dienoate) |
| SMILES | CC(C)=CCC/C(C)=C\C(=O)[O-].CC(C)=CCC/C(C)=C\C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C10H16O2.Ba/c2*1-8(2)5-4-6-9(3)7-10(11)12;/h2*5,7H,4,6H2,1-3H3,(H,11,12);/q;;+2/p-2/b2*9-7-; |
| InChIKey | DSBIFYMTPTYTPO-LHSHWCRNSA-L |
| XLogP | 2.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|