C22H38NO+ — CID 91262041
3,7-dimethylocta-2,6-dienoyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium (PubChem CID 91262041) has the molecular formula C22H38NO+ and a molecular weight of 332.55 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienoyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium.
| Compound Name | 3,7-dimethylocta-2,6-dienoyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium |
|---|---|
| PubChem CID | 91262041 |
| Molecular Formula | C22H38NO+ |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienoyl-(3,7-dimethylocta-2,6-dienyl)-dimethylazanium |
| SMILES | CC(C)=CCCC(C)=CC[N+](C)(C)C(=O)C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C22H38NO/c1-18(2)11-9-13-20(5)15-16-23(7,8)22(24)17-21(6)14-10-12-19(3)4/h11-12,15,17H,9-10,13-14,16H2,1-8H3/q+1 |
| InChIKey | BBUNUGFOYGZANR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|