C16H24N2O — CID 135570572
(1Z,3E,7E)-1-diazo-4,8,12-trimethyltrideca-3,7,11-trien-2-one (PubChem CID 135570572) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (1Z,3E,7E)-1-diazo-4,8,12-trimethyltrideca-3,7,11-trien-2-one.
| Compound Name | (1Z,3E,7E)-1-diazo-4,8,12-trimethyltrideca-3,7,11-trien-2-one |
|---|---|
| PubChem CID | 135570572 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (1Z,3E,7E)-1-diazo-4,8,12-trimethyltrideca-3,7,11-trien-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C16H24N2O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-16(19)12-18-17/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| InChIKey | DCTHWPOVMWIGPB-YFVJMOTDSA-N |
| XLogP | 4.28 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|