C17H26O — CID 10060501
(9E)-10,14-dimethylpentadeca-9,13-dien-5-yn-2-one (PubChem CID 10060501) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (9E)-10,14-dimethylpentadeca-9,13-dien-5-yn-2-one.
| Compound Name | (9E)-10,14-dimethylpentadeca-9,13-dien-5-yn-2-one |
|---|---|
| PubChem CID | 10060501 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (9E)-10,14-dimethylpentadeca-9,13-dien-5-yn-2-one |
| SMILES | CC(=O)CCC#CCC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H26O/c1-15(2)11-10-13-16(3)12-8-6-5-7-9-14-17(4)18/h11-12H,6,8-10,13-14H2,1-4H3/b16-12+ |
| InChIKey | ANEHFVWKVJFOEH-FOWTUZBSSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|