C21H36Si — CID 73095183
trimethyl(6,10,14-trimethylpentadeca-5,9,13-trien-1-ynyl)silane (PubChem CID 73095183) has the molecular formula C21H36Si and a molecular weight of 316.61 g/mol. Its IUPAC name is trimethyl(6,10,14-trimethylpentadeca-5,9,13-trien-1-ynyl)silane.
| Compound Name | trimethyl(6,10,14-trimethylpentadeca-5,9,13-trien-1-ynyl)silane |
|---|---|
| PubChem CID | 73095183 |
| Molecular Formula | C21H36Si |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | trimethyl(6,10,14-trimethylpentadeca-5,9,13-trien-1-ynyl)silane |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H36Si/c1-19(2)13-11-15-21(4)17-12-16-20(3)14-9-8-10-18-22(5,6)7/h13-14,17H,8-9,11-12,15-16H2,1-7H3 |
| InChIKey | WWILOFJTMIMTGR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|