C38H58O2SSi — CID 10995646
trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyl-8-(4-methylphenyl)sulfonyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane (PubChem CID 10995646) has the molecular formula C38H58O2SSi and a molecular weight of 607.03 g/mol. Its IUPAC name is trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyl-8-(4-methylphenyl)sulfonyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane.
| Compound Name | trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyl-8-(4-methylphenyl)sulfonyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane |
|---|---|
| PubChem CID | 10995646 |
| Molecular Formula | C38H58O2SSi |
| Molecular Weight | 607.03 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyl-8-(4-methylphenyl)sulfonyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(C/C(C)=C/CCC#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H58O2SSi/c1-31(2)17-14-19-32(3)20-15-21-33(4)22-16-23-36(7)30-38(41(39,40)37-26-24-34(5)25-27-37)29-35(6)18-12-11-13-28-42(8,9)10/h17-18,20,22,24-27,30,38H,11-12,14-16,19,21,23,29H2,1-10H3/b32-20+,33-22+,35-18+,36-30+ |
| InChIKey | YZJTZHYIYHVRQF-WAEAWZNPSA-N |
| XLogP | 11.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.03 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|