C20H28O2S — CID 12748555
1-[(5E)-6,10-dimethylundeca-1,5,9-trien-3-yl]sulfonyl-4-methylbenzene (PubChem CID 12748555) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-[(5E)-6,10-dimethylundeca-1,5,9-trien-3-yl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(5E)-6,10-dimethylundeca-1,5,9-trien-3-yl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 12748555 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(5E)-6,10-dimethylundeca-1,5,9-trien-3-yl]sulfonyl-4-methylbenzene |
| SMILES | C=CC(C/C=C(\C)CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28O2S/c1-6-19(13-10-17(4)9-7-8-16(2)3)23(21,22)20-14-11-18(5)12-15-20/h6,8,10-12,14-15,19H,1,7,9,13H2,2-5H3/b17-10+ |
| InChIKey | QHIOPAGBWSNDJJ-LICLKQGHSA-N |
| XLogP | 5.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|