C19H26O5S — CID 18416888
(4E)-2-(4-methoxyphenyl)sulfonyl-5,9-dimethyldeca-4,8-dienoic acid (PubChem CID 18416888) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is (4E)-2-(4-methoxyphenyl)sulfonyl-5,9-dimethyldeca-4,8-dienoic acid.
| Compound Name | (4E)-2-(4-methoxyphenyl)sulfonyl-5,9-dimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 18416888 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (4E)-2-(4-methoxyphenyl)sulfonyl-5,9-dimethyldeca-4,8-dienoic acid |
| SMILES | COc1ccc(S(=O)(=O)C(C/C=C(\C)CCC=C(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H26O5S/c1-14(2)6-5-7-15(3)8-13-18(19(20)21)25(22,23)17-11-9-16(24-4)10-12-17/h6,8-12,18H,5,7,13H2,1-4H3,(H,20,21)/b15-8+ |
| InChIKey | QFRKIYOEPHSNON-OVCLIPMQSA-N |
| XLogP | 4.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|