C17H25NO3S — CID 162639468
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzenesulfonamide (PubChem CID 162639468) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 162639468 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-14(2)6-5-7-15(3)12-13-18-22(19,20)17-10-8-16(21-4)9-11-17/h6,8-12,18H,5,7,13H2,1-4H3/b15-12+ |
| InChIKey | URYKLVMRRWYTHF-NTCAYCPXSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|