C17H25NO2S — CID 101397381
N-[(2E,6E)-2,6-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide (PubChem CID 101397381) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[(2E,6E)-2,6-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2E,6E)-2,6-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101397381 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[(2E,6E)-2,6-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C/C=C(\C)CC/C=C(\C)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO2S/c1-5-14(2)7-6-8-16(4)13-18-21(19,20)17-11-9-15(3)10-12-17/h5,8-12,18H,6-7,13H2,1-4H3/b14-5+,16-8+ |
| InChIKey | SRKBYKSSLPKPNX-JQXFOXAESA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|