C13H19NO2S — CID 13215821
N-[(E)-hex-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 13215821) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-[(E)-hex-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-hex-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 13215821 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(E)-hex-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | CCC/C=C/CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-3-4-5-6-11-14-17(15,16)13-9-7-12(2)8-10-13/h5-10,14H,3-4,11H2,1-2H3/b6-5+ |
| InChIKey | LMVOHFPVVXDYKJ-AATRIKPKSA-N |
| XLogP | 2.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|