C15H19NO3S — CID 122390713
N-[(Z)-8-hydroxyoct-2-en-6-ynyl]-4-methylbenzenesulfonamide (PubChem CID 122390713) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[(Z)-8-hydroxyoct-2-en-6-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-8-hydroxyoct-2-en-6-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122390713 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[(Z)-8-hydroxyoct-2-en-6-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC/C=C\CCC#CCO)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-14-8-10-15(11-9-14)20(18,19)16-12-6-4-2-3-5-7-13-17/h4,6,8-11,16-17H,2-3,12-13H2,1H3/b6-4- |
| InChIKey | XGFALGBIWSBDPJ-XQRVVYSFSA-N |
| XLogP | 1.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|