C20H21NO4S — CID 71659657
benzyl (2E,4Z)-6-[(4-methylphenyl)sulfonylamino]hexa-2,4-dienoate (PubChem CID 71659657) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is benzyl (2E,4Z)-6-[(4-methylphenyl)sulfonylamino]hexa-2,4-dienoate.
| Compound Name | benzyl (2E,4Z)-6-[(4-methylphenyl)sulfonylamino]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 71659657 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | benzyl (2E,4Z)-6-[(4-methylphenyl)sulfonylamino]hexa-2,4-dienoate |
| SMILES | Cc1ccc(S(=O)(=O)NC/C=C\C=C\C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-17-11-13-19(14-12-17)26(23,24)21-15-7-3-6-10-20(22)25-16-18-8-4-2-5-9-18/h2-14,21H,15-16H2,1H3/b7-3-,10-6+ |
| InChIKey | ROVGVZOXBGDFMN-PFWVIDTOSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|