C21H26N2O6S — CID 162807181
2-[methyl(phenylmethoxycarbonyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoic acid (PubChem CID 162807181) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[methyl(phenylmethoxycarbonyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[methyl(phenylmethoxycarbonyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 162807181 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[methyl(phenylmethoxycarbonyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(C(=O)O)N(C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-16-10-12-18(13-11-16)30(27,28)22-14-6-9-19(20(24)25)23(2)21(26)29-15-17-7-4-3-5-8-17/h3-5,7-8,10-13,19,22H,6,9,14-15H2,1-2H3,(H,24,25) |
| InChIKey | SLWIADLDBVNVCL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|