C21H24N2O5 — CID 10894293
N-[(4S)-4-carboxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]-1-phenylmethanimine oxide (PubChem CID 10894293) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[(4S)-4-carboxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]-1-phenylmethanimine oxide.
| Compound Name | N-[(4S)-4-carboxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 10894293 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(4S)-4-carboxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]-1-phenylmethanimine oxide |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H](CCC/[N+]([O-])=C\c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H24N2O5/c1-22(21(26)28-16-18-11-6-3-7-12-18)19(20(24)25)13-8-14-23(27)15-17-9-4-2-5-10-17/h2-7,9-12,15,19H,8,13-14,16H2,1H3,(H,24,25)/b23-15+/t19-/m0/s1 |
| InChIKey | JIOKAFNOHUVMOL-CKMDTHJYSA-N |
| XLogP | 3.12 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|