C22H23NO4S — CID 7683582
(4-methylphenyl)methyl 4-(naphthalen-2-ylsulfonylamino)butanoate (PubChem CID 7683582) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (4-methylphenyl)methyl 4-(naphthalen-2-ylsulfonylamino)butanoate.
| Compound Name | (4-methylphenyl)methyl 4-(naphthalen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 7683582 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (4-methylphenyl)methyl 4-(naphthalen-2-ylsulfonylamino)butanoate |
| SMILES | Cc1ccc(COC(=O)CCCNS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-17-8-10-18(11-9-17)16-27-22(24)7-4-14-23-28(25,26)21-13-12-19-5-2-3-6-20(19)15-21/h2-3,5-6,8-13,15,23H,4,7,14,16H2,1H3 |
| InChIKey | QFEXLMONPSPZMY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|