C23H23NO6S — CID 31396725
methyl 3-[4-(naphthalen-2-ylsulfonylamino)butanoyloxymethyl]benzoate (PubChem CID 31396725) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 3-[4-(naphthalen-2-ylsulfonylamino)butanoyloxymethyl]benzoate.
| Compound Name | methyl 3-[4-(naphthalen-2-ylsulfonylamino)butanoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 31396725 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | methyl 3-[4-(naphthalen-2-ylsulfonylamino)butanoyloxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC(=O)CCCNS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H23NO6S/c1-29-23(26)20-9-4-6-17(14-20)16-30-22(25)10-5-13-24-31(27,28)21-12-11-18-7-2-3-8-19(18)15-21/h2-4,6-9,11-12,14-15,24H,5,10,13,16H2,1H3 |
| InChIKey | XGHWGFLWVLWCBK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|