C21H20FNO5S — CID 7806955
(3-fluoro-4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7806955) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7806955 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | COc1ccc(COC(=O)CCNS(=O)(=O)c2ccc3ccccc3c2)cc1F |
| InChI | InChI=1S/C21H20FNO5S/c1-27-20-9-6-15(12-19(20)22)14-28-21(24)10-11-23-29(25,26)18-8-7-16-4-2-3-5-17(16)13-18/h2-9,12-13,23H,10-11,14H2,1H3 |
| InChIKey | XUVGANDIXVEUCQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |