C16H15F2NO5S — CID 7954170
(3-fluoro-4-methoxyphenyl)methyl 2-[(4-fluorophenyl)sulfonylamino]acetate (PubChem CID 7954170) has the molecular formula C16H15F2NO5S and a molecular weight of 371.36 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 2-[(4-fluorophenyl)sulfonylamino]acetate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 2-[(4-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7954170 |
| Molecular Formula | C16H15F2NO5S |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 2-[(4-fluorophenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(COC(=O)CNS(=O)(=O)c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C16H15F2NO5S/c1-23-15-7-2-11(8-14(15)18)10-24-16(20)9-19-25(21,22)13-5-3-12(17)4-6-13/h2-8,19H,9-10H2,1H3 |
| InChIKey | MYFCQAILQBSGDD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |