C18H18N2O6S — CID 8664523
(4-cyanophenyl)methyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate (PubChem CID 8664523) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate.
| Compound Name | (4-cyanophenyl)methyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 8664523 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)OCc2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C18H18N2O6S/c1-24-16-8-7-15(9-17(16)25-2)27(22,23)20-11-18(21)26-12-14-5-3-13(10-19)4-6-14/h3-9,20H,11-12H2,1-2H3 |
| InChIKey | LOYGVPJHRYZRCG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |