C19H18N2O6S — CID 7725584
ethyl 4-[[2-[(4-cyanophenyl)methoxy]-2-oxoethyl]sulfamoyl]benzoate (PubChem CID 7725584) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-cyanophenyl)methoxy]-2-oxoethyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[2-[(4-cyanophenyl)methoxy]-2-oxoethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7725584 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | ethyl 4-[[2-[(4-cyanophenyl)methoxy]-2-oxoethyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCC(=O)OCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H18N2O6S/c1-2-26-19(23)16-7-9-17(10-8-16)28(24,25)21-12-18(22)27-13-15-5-3-14(11-20)4-6-15/h3-10,21H,2,12-13H2,1H3 |
| InChIKey | XIVZYZCOYUCQEG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |