C17H13F3N2O4S — CID 39605970
[4-(trifluoromethyl)phenyl]methyl 2-[(4-cyanophenyl)sulfonylamino]acetate (PubChem CID 39605970) has the molecular formula C17H13F3N2O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-[(4-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-[(4-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 39605970 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-[(4-cyanophenyl)sulfonylamino]acetate |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC(=O)OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H13F3N2O4S/c18-17(19,20)14-5-1-13(2-6-14)11-26-16(23)10-22-27(24,25)15-7-3-12(9-21)4-8-15/h1-8,22H,10-11H2 |
| InChIKey | CPFPACUYJGBJBP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |