C12H11ClN2O4S — CID 46543973
2-chloroprop-2-enyl 2-[(4-cyanophenyl)sulfonylamino]acetate (PubChem CID 46543973) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[(4-cyanophenyl)sulfonylamino]acetate.
| Compound Name | 2-chloroprop-2-enyl 2-[(4-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 46543973 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[(4-cyanophenyl)sulfonylamino]acetate |
| SMILES | C=C(Cl)COC(=O)CNS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H11ClN2O4S/c1-9(13)8-19-12(16)7-15-20(17,18)11-4-2-10(6-14)3-5-11/h2-5,15H,1,7-8H2 |
| InChIKey | LFWJBECHHKKVKO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |