C17H21N3O5S — CID 7679422
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate (PubChem CID 7679422) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7679422 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-[(4-cyanophenyl)sulfonylamino]acetate |
| SMILES | C[C@@H](OC(=O)CNS(=O)(=O)c1ccc(C#N)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H21N3O5S/c1-12(17(22)20-14-4-2-3-5-14)25-16(21)11-19-26(23,24)15-8-6-13(10-18)7-9-15/h6-9,12,14,19H,2-5,11H2,1H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | UYIISNOIUDGSSH-GFCCVEGCSA-N |
| XLogP | 0.83 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |