C20H24N2O5S — CID 7906445
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(naphthalen-2-ylsulfonylamino)acetate (PubChem CID 7906445) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(naphthalen-2-ylsulfonylamino)acetate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(naphthalen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 7906445 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(naphthalen-2-ylsulfonylamino)acetate |
| SMILES | C[C@@H](OC(=O)CNS(=O)(=O)c1ccc2ccccc2c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H24N2O5S/c1-14(20(24)22-17-8-4-5-9-17)27-19(23)13-21-28(25,26)18-11-10-15-6-2-3-7-16(15)12-18/h2-3,6-7,10-12,14,17,21H,4-5,8-9,13H2,1H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | ODURAPWJHIXWJP-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |