C20H23NO4 — CID 3667679
[1-(cyclopentylamino)-1-oxopropan-2-yl] 2-naphthalen-2-yloxyacetate (PubChem CID 3667679) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 3667679 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 2-naphthalen-2-yloxyacetate |
| SMILES | CC(OC(=O)COc1ccc2ccccc2c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H23NO4/c1-14(20(23)21-17-8-4-5-9-17)25-19(22)13-24-18-11-10-15-6-2-3-7-16(15)12-18/h2-3,6-7,10-12,14,17H,4-5,8-9,13H2,1H3,(H,21,23) |
| InChIKey | URKKNIZGZUTWFI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |