C19H27NO4 — CID 8598408
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 8598408) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 8598408 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccc(OCC(=O)O[C@H](C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-13(2)15-8-10-17(11-9-15)23-12-18(21)24-14(3)19(22)20-16-6-4-5-7-16/h8-11,13-14,16H,4-7,12H2,1-3H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | MRHFRXXERMAUFF-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |