C18H24ClNO4 — CID 7750592
[(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate (PubChem CID 7750592) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7750592 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-(4-chlorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(Cl)cc1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C18H24ClNO4/c1-13(18(22)20-11-14-5-3-2-4-6-14)24-17(21)12-23-16-9-7-15(19)8-10-16/h7-10,13-14H,2-6,11-12H2,1H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | BFUMWULUMFKLKD-ZDUSSCGKSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |