C20H18ClNO4S — CID 7906485
[(1S)-1-(2-chlorophenyl)ethyl] 2-(naphthalen-2-ylsulfonylamino)acetate (PubChem CID 7906485) has the molecular formula C20H18ClNO4S and a molecular weight of 403.89 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl] 2-(naphthalen-2-ylsulfonylamino)acetate.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(naphthalen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 7906485 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl] 2-(naphthalen-2-ylsulfonylamino)acetate |
| SMILES | C[C@H](OC(=O)CNS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClNO4S/c1-14(18-8-4-5-9-19(18)21)26-20(23)13-22-27(24,25)17-11-10-15-6-2-3-7-16(15)12-17/h2-12,14,22H,13H2,1H3/t14-/m0/s1 |
| InChIKey | OUTCKTYFTVYDOL-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |