C16H18N2O5S — CID 7414439
[(2R)-1-amino-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7414439) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7414439 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | C[C@@H](OC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C16H18N2O5S/c1-11(16(17)20)23-15(19)8-9-18-24(21,22)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10-11,18H,8-9H2,1H3,(H2,17,20)/t11-/m1/s1 |
| InChIKey | BAVQBGHFDAUBEO-LLVKDONJSA-N |
| XLogP | 0.93 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |