C23H32N2O5S — CID 16565170
[2-(6-methylheptan-2-ylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 16565170) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 16565170 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | CC(C)CCCC(C)NC(=O)COC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H32N2O5S/c1-17(2)7-6-8-18(3)25-22(26)16-30-23(27)13-14-24-31(28,29)21-12-11-19-9-4-5-10-20(19)15-21/h4-5,9-12,15,17-18,24H,6-8,13-14,16H2,1-3H3,(H,25,26) |
| InChIKey | VXQRPFQXUBANIP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |