C21H21NO5S — CID 16577982
(4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 16577982) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 16577982 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | COc1ccc(COC(=O)CCNS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-26-19-9-6-16(7-10-19)15-27-21(23)12-13-22-28(24,25)20-11-8-17-4-2-3-5-18(17)14-20/h2-11,14,22H,12-13,15H2,1H3 |
| InChIKey | PMBONHVIBDSYRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |