C24H25N3O6S — CID 55421930
[1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 55421930) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 55421930 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | CC(OC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H25N3O6S/c1-17(23(29)27-24(30)25-16-18-7-3-2-4-8-18)33-22(28)13-14-26-34(31,32)21-12-11-19-9-5-6-10-20(19)15-21/h2-12,15,17,26H,13-14,16H2,1H3,(H2,25,27,29,30) |
| InChIKey | NNUDDOUUSBWOIL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |