C19H21FN2O5S — CID 8880063
[(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate (PubChem CID 8880063) has the molecular formula C19H21FN2O5S and a molecular weight of 408.45 g/mol. Its IUPAC name is [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 8880063 |
| Molecular Formula | C19H21FN2O5S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate |
| SMILES | C[C@@H](OC(=O)CCNS(=O)(=O)c1ccccc1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O5S/c1-14(19(24)21-13-15-7-9-16(20)10-8-15)27-18(23)11-12-22-28(25,26)17-5-3-2-4-6-17/h2-10,14,22H,11-13H2,1H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | TYINBVNPBCYNJT-CQSZACIVSA-N |
| XLogP | 1.74 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |