C19H20FNO3 — CID 9063142
[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate (PubChem CID 9063142) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate.
| Compound Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 9063142 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)O[C@@H](C)C(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FNO3/c1-13-3-5-15(6-4-13)11-18(22)24-14(2)19(23)21-12-16-7-9-17(20)10-8-16/h3-10,14H,11-12H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | WZYPOJMWUWTCNY-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |