C18H25FN2O4 — CID 55734617
[1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 6-acetamidohexanoate (PubChem CID 55734617) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 6-acetamidohexanoate.
| Compound Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55734617 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OC(C)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN2O4/c1-13(18(24)21-12-15-7-9-16(19)10-8-15)25-17(23)6-4-3-5-11-20-14(2)22/h7-10,13H,3-6,11-12H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | DJMYATXKNLKMPA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|